23012-23-9 Usage
Uses
Used in Pharmaceutical Industry:
5-Oxazolecarboxylic acid, 4-methyl-, methyl ester (6CI, 8CI, 9CI) is used as an intermediate in the production of various pharmaceuticals. Its unique chemical properties make it a valuable component in the synthesis of drugs with specific therapeutic effects.
Used in Agrochemical Industry:
5-Oxazolecarboxylicacid,4-methyl-,methylester(6CI,8CI,9CI) is also used as an intermediate in the production of agrochemicals, contributing to the development of effective pesticides and other agricultural products.
Used in Organic Synthesis:
5-Oxazolecarboxylic acid, 4-methyl-, methyl ester (6CI, 8CI, 9CI) is utilized in organic synthesis for the creation of various chemical compounds, showcasing its versatility in chemical reactions.
Used in Research and Development:
Due to its unique properties, 5-Oxazolecarboxylicacid,4-methyl-,methylester(6CI,8CI,9CI) is used in research and development for the exploration of new materials and specialty chemicals, potentially leading to innovative applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 23012-23-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,0,1 and 2 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 23012-23:
(7*2)+(6*3)+(5*0)+(4*1)+(3*2)+(2*2)+(1*3)=49
49 % 10 = 9
So 23012-23-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H7NO3/c1-4-5(6(8)9-2)10-3-7-4/h3H,1-2H3