230295-12-2 Usage
Description
2,3,6-Trifluorocinnamic acid, with the chemical formula C9H5F3O2, is a white to pale yellow solid that exhibits a melting point of 125-128°C. This versatile chemical serves as a crucial intermediate in various synthesis processes and is widely recognized for its applications across different industries.
Uses
Used in Pharmaceutical Industry:
2,3,6-Trifluorocinnamic acid is utilized as an intermediate in the synthesis of pharmaceutical compounds, playing a pivotal role in the development of new drugs and therapeutic agents.
Used in High-Performance Polymers Production:
2,3,6-TRIFLUOROCINNAMIC ACID is employed in the production of high-performance polymers, which are essential for various applications due to their superior properties, such as strength, durability, and heat resistance.
Used in Photoelectric Materials Industry:
2,3,6-Trifluorocinnamic acid is used in the development of photoelectric materials, which are crucial for applications in solar cells, light-emitting diodes (LEDs), and other optoelectronic devices.
Used in Organic Synthesis:
As a building block, 2,3,6-trifluorocinnamic acid is involved in organic synthesis, allowing for the creation of a diverse range of chemical compounds with various applications.
Used in Preparation of Biologically Active Compounds:
This versatile chemical is also used in the preparation of biologically active compounds, which can have potential applications in medicine, agriculture, and other fields.
Check Digit Verification of cas no
The CAS Registry Mumber 230295-12-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,3,0,2,9 and 5 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 230295-12:
(8*2)+(7*3)+(6*0)+(5*2)+(4*9)+(3*5)+(2*1)+(1*2)=102
102 % 10 = 2
So 230295-12-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H5F3O2/c10-6-2-3-7(11)9(12)5(6)1-4-8(13)14/h1-4H,(H,13,14)/b4-1+
