230297-45-7 Usage
General Description
2-Tetrahydrofuranyloxy carbonyl 5-norbornene is a complex organic chemical compound that figures prominently in the sphere of chemical research and development. This chemical features the fusion of three distinctive moieties: 2-tetrahydrofuran, carbonyl, and 5-norbornene. It's detail structure and properties, including its molecular weight, polarity, melting point, boiling point, toxicity, and reactivity, largely depend on the specific arrangement of these components. It's essential to mention that specific handling and storage instructions are associated with this compound, typically provided by the manufacturer or relevant safety data sheets. The compound's applications are mainly focused on scientific research and synthetic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 230297-45-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,3,0,2,9 and 7 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 230297-45:
(8*2)+(7*3)+(6*0)+(5*2)+(4*9)+(3*7)+(2*4)+(1*5)=117
117 % 10 = 7
So 230297-45-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H16O3/c13-12(15-11-2-1-5-14-11)10-7-8-3-4-9(10)6-8/h3-4,8-11H,1-2,5-7H2