23056-44-2 Usage
Uses
Used in Organic Synthesis:
3-Nitro-4-bromopyridine is used as a key intermediate in the synthesis of various organic compounds. Its presence in the molecular structure allows for the formation of a wide range of chemical products, making it a valuable component in the field of organic chemistry.
Used in Pharmaceutical Production:
3-Nitro-4-bromopyridine is used as a building block in the development of pharmaceuticals. Its unique structure and functional groups enable the creation of new drug molecules with potential therapeutic applications, contributing to the advancement of medicine and healthcare.
Used in Chemical Research:
3-Nitro-4-bromopyridine is employed as a research compound in the study of chemical reactions and mechanisms. Its reactivity and structural properties make it an interesting subject for scientists to explore, leading to a better understanding of chemical processes and the development of new synthetic methods.
Used in Material Science:
3-Nitro-4-bromopyridine is used as a component in the development of new materials with specific properties. Its incorporation into the molecular structure of various compounds can result in materials with unique characteristics, such as improved stability, reactivity, or other desirable traits, which can be applied in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 23056-44-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,0,5 and 6 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 23056-44:
(7*2)+(6*3)+(5*0)+(4*5)+(3*6)+(2*4)+(1*4)=82
82 % 10 = 2
So 23056-44-2 is a valid CAS Registry Number.
InChI:InChI=1/C5H3BrN2O2/c6-4-1-2-7-3-5(4)8(9)10/h1-3H
