230618-24-3 Usage
Uses
Used in Chemical Synthesis:
6-Pyrrolidin-1-ylpyridine-2-carbaldehyde is used as a key intermediate in the synthesis of various organic compounds. Its unique structure allows it to participate in a range of chemical reactions, facilitating the creation of new molecules with specific properties and applications.
Used in Experimental Research:
In the field of experimental research, 6-Pyrrolidin-1-ylpyridine-2-carbaldehyde serves as a valuable compound for studying chemical reactions and mechanisms. Its reactivity and structural features make it an interesting subject for investigations aimed at understanding and optimizing synthetic pathways.
Used in Pharmaceutical Industry:
6-Pyrrolidin-1-ylpyridine-2-carbaldehyde is used as a building block in the development of pharmaceutical compounds. Its ability to form stable complexes with other molecules makes it a promising candidate for the creation of new drugs with potential therapeutic applications.
Used in Material Science:
In material science, 6-Pyrrolidin-1-ylpyridine-2-carbaldehyde may be employed in the design and synthesis of novel materials with specific properties. Its structural characteristics can contribute to the development of materials with improved performance in various applications, such as sensors, catalysts, or advanced materials for energy storage and conversion.
Used in Analytical Chemistry:
6-Pyrrolidin-1-ylpyridine-2-carbaldehyde can be utilized as a reagent or a reference compound in analytical chemistry. Its distinct chemical properties may be leveraged for the development of new analytical methods or for the calibration of instruments in various analytical techniques.
Check Digit Verification of cas no
The CAS Registry Mumber 230618-24-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,3,0,6,1 and 8 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 230618-24:
(8*2)+(7*3)+(6*0)+(5*6)+(4*1)+(3*8)+(2*2)+(1*4)=103
103 % 10 = 3
So 230618-24-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H12N2O/c13-8-9-4-3-5-10(11-9)12-6-1-2-7-12/h3-5,8H,1-2,6-7H2
