230618-24-3 Usage
General Description
6-Pyrrolidin-1-ylpyridine-2-carbaldehyde is a chemical compound with the molecular formula C10H12N2O. As an organic compound, it is especially known for its usage in various chemical synthesis processes and experimental research. Its chemical structure consists of a pyridine ring attached to a pyrrolidine ring, with the presence of a carbonyl group. The exact properties such as melting point, boiling point, or specific rotation of this compound may vary depending on its specific environment or conditions. This chemical should be handled with protective equipment due to the potential risks associated with exposure or ingestion.
Check Digit Verification of cas no
The CAS Registry Mumber 230618-24-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,3,0,6,1 and 8 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 230618-24:
(8*2)+(7*3)+(6*0)+(5*6)+(4*1)+(3*8)+(2*2)+(1*4)=103
103 % 10 = 3
So 230618-24-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H12N2O/c13-8-9-4-3-5-10(11-9)12-6-1-2-7-12/h3-5,8H,1-2,6-7H2