23066-21-9 Usage
Uses
Used in Pharmaceutical Industry:
3-Chloro-2-nitrophenylacetic acid is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the development of new drug molecules. Its unique functional groups facilitate chemical reactions that are crucial in the production of therapeutic agents.
Used in Agrochemical Industry:
3-Chloro-2-nitrophenylacetic acid is utilized as an intermediate in the synthesis of agrochemicals, specifically for its antifungal and herbicidal properties. It aids in the development of compounds that protect crops from fungal infections and unwanted plant growth, thereby enhancing agricultural productivity.
Used in Organic Chemistry Research and Development:
3-Chloro-2-nitrophenylacetic acid serves as an important building block in the creation of various organic compounds. Its presence in chemical reactions can lead to the formation of new molecules with potential applications in a wide range of industries, including but not limited to pharmaceuticals, materials science, and agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 23066-21-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,0,6 and 6 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 23066-21:
(7*2)+(6*3)+(5*0)+(4*6)+(3*6)+(2*2)+(1*1)=79
79 % 10 = 9
So 23066-21-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H6ClNO4/c9-6-3-1-2-5(4-7(11)12)8(6)10(13)14/h1-3H,4H2,(H,11,12)
