23085-45-2 Usage
Class of compound
Benzimidazole derivative
Type of compound
Ketone
Structural features
Chlorine atom attached to benzimidazole ring, phenyl group attached to ketone carbon
Potential applications
Medicinal chemistry and drug development
Need for further research
To fully understand properties and potential uses
Check Digit Verification of cas no
The CAS Registry Mumber 23085-45-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,0,8 and 5 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 23085-45:
(7*2)+(6*3)+(5*0)+(4*8)+(3*5)+(2*4)+(1*5)=92
92 % 10 = 2
So 23085-45-2 is a valid CAS Registry Number.
InChI:InChI=1/C15H11ClN2O/c16-15-17-12-8-4-5-9-13(12)18(15)10-14(19)11-6-2-1-3-7-11/h1-9H,10H2
