23111-03-7 Usage
Chemical structure
2,2-dimethyl-5-(1H-pyrrol-2-ylmethylene)-1,3-dioxane-4,6-dione
Type of compound
Dioxane derivative
Functional group
Pyrrole group attached to the carbon atom
Physical state
Yellow solid
Potential applications
Organic synthesis, medicinal chemistry
Usage
Building block in the synthesis of various organic compounds and pharmaceuticals
Unique properties
Presence of the pyrrole group
Versatility
Versatile intermediate in chemical reactions
Ongoing research
Properties and potential applications in the field of organic chemistry
Check Digit Verification of cas no
The CAS Registry Mumber 23111-03-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,1,1 and 1 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 23111-03:
(7*2)+(6*3)+(5*1)+(4*1)+(3*1)+(2*0)+(1*3)=47
47 % 10 = 7
So 23111-03-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H11NO4/c1-11(2)15-9(13)8(10(14)16-11)6-7-4-3-5-12-7/h3-6,12H,1-2H3
