23142-41-8 Usage
General Description
2-[3-Chloro-4-(pentyloxy)phenyl]acetohydroxamic acid is a chemical compound with the molecular formula C13H16ClNO4. It is a derivative of hydroxamic acid and has a chloro-substituted phenyl ring with a pentyloxy group attached to it. The compound is commonly used as a chelating agent in analytical chemistry and is known for its ability to bind to metal ions. It has also been studied for its potential therapeutic applications, particularly in the treatment of cancer and other diseases. The compound's structure and properties make it a promising candidate for further research and development in the field of medicinal chemistry and pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 23142-41-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,1,4 and 2 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 23142-41:
(7*2)+(6*3)+(5*1)+(4*4)+(3*2)+(2*4)+(1*1)=68
68 % 10 = 8
So 23142-41-8 is a valid CAS Registry Number.
InChI:InChI=1/C13H18ClNO3/c1-2-3-4-7-18-12-6-5-10(8-11(12)14)9-13(16)15-17/h5-6,8,17H,2-4,7,9H2,1H3,(H,15,16)
