23169-33-7 Usage
Uses
Used in Pharmaceutical Industry:
9-(2-Hydroxyethyl)guanine is used as an impurity in the production of the antiviral agent Acyclovir (A192400) for its role in the treatment of viral infections. As a nucleoside phosphotransferase acceptor, it plays a crucial part in the mechanism of action of Acyclovir, contributing to its antiviral properties and effectiveness against various viral diseases.
Additionally, due to its acceptance by nucleoside phosphotransferase, 9-(2-Hydroxyethyl)guanine may also be utilized in research and development for the creation of new antiviral drugs or the improvement of existing ones, potentially enhancing their efficacy and safety profiles.
Check Digit Verification of cas no
The CAS Registry Mumber 23169-33-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,1,6 and 9 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 23169-33:
(7*2)+(6*3)+(5*1)+(4*6)+(3*9)+(2*3)+(1*3)=97
97 % 10 = 7
So 23169-33-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H9N5O2/c8-7-10-5-4(6(14)11-7)9-3-12(5)1-2-13/h3,13H,1-2H2,(H3,8,10,11,14)
