23202-85-9 Usage
Description
(3R,4S)-3-[[4-(β-D-Glucopyranosyloxy)-3-methoxyphenyl]methyl]-4,5-dihydro-4-[(4-hydroxy-3-methoxyphenyl)methyl]furan-2(3H)-one is a complex organic chemical compound characterized by a furan ring and multiple hydroxyl and methoxy substituents. It features phenyl and glucose moieties, suggesting a likely natural product origin. (3R,4S)-3-[[4-(β-D-Glucopyranosyloxy)-3-methoxyphenyl]methyl]-4,5-dihydro-4-[(4-hydroxy-3-methoxyphenyl)methyl]furan-2(3H)-one's structural intricacy and functional groups may endow it with potential biological activities, making it a candidate of interest for pharmaceutical or agrochemical research. Further investigation is required to elucidate its specific properties and possible applications.
Uses
Given the provided materials, there are no explicit uses listed for (3R,4S)-3-[[4-(β-D-Glucopyranosyloxy)-3-methoxyphenyl]methyl]-4,5-dihydro-4-[(4-hydroxy-3-methoxyphenyl)methyl]furan-2(3H)-one. However, based on its structural features, we can hypothesize potential applications:
Used in Pharmaceutical Research:
(3R,4S)-3-[[4-(β-D-Glucopyranosyloxy)-3-methoxyphenyl]methyl]-4,5-dihydro-4-[(4-hydroxy-3-methoxyphenyl)methyl]furan-2(3H)-one could be used as a lead compound for drug development due to its complex structure and potential biological activities. The presence of phenolic and furan functionalities may contribute to pharmacological properties, such as antioxidant or enzyme inhibitory actions.
Used in Agrochemical Research:
In agrochemicals, this compound might be explored for its potential as a pesticide or herbicide, given the natural product-like structure that could interact with specific biological targets in pests or weeds.
Used in Chemical Synthesis:
As a complex organic molecule, it could serve as an intermediate in the synthesis of other bioactive compounds or materials with specialized properties.
Check Digit Verification of cas no
The CAS Registry Mumber 23202-85-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,2,0 and 2 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 23202-85:
(7*2)+(6*3)+(5*2)+(4*0)+(3*2)+(2*8)+(1*5)=69
69 % 10 = 9
So 23202-85-9 is a valid CAS Registry Number.
InChI:InChI=1/C26H32O11/c1-33-19-9-13(3-5-17(19)28)7-15-12-35-25(32)16(15)8-14-4-6-18(20(10-14)34-2)36-26-24(31)23(30)22(29)21(11-27)37-26/h3-6,9-10,15-16,21-24,26-31H,7-8,11-12H2,1-2H3/t15-,16+,21+,22+,23-,24+,26+/m0/s1