232275-38-6 Usage
Uses
Used in Pharmaceutical and Drug Discovery:
4-(1,3-Dioxolan-2-yl)-2,6-dimethoxyphenylboronic Acid is used as a key intermediate in the synthesis of various pharmaceutical compounds due to its unique reactivity and protective functionalities. Its ability to form stable complexes with other organic molecules aids in the development of new drugs with improved efficacy and selectivity.
Used in Materials Science:
In the field of materials science, 4-(1,3-Dioxolan-2-yl)-2,6-dimethoxyphenylboronic Acid is utilized as a building block for the creation of novel materials with specific properties. Its unique structure allows for the design of materials with tailored characteristics, such as improved thermal stability, enhanced electrical conductivity, or specific optical properties.
Used in Suzuki Coupling Reactions:
4-(1,3-Dioxolan-2-yl)-2,6-dimethoxyphenylboronic Acid is employed as a reactant in Suzuki coupling reactions, a widely used method in organic synthesis for the formation of carbon-carbon bonds. Its specific reactivity and protective functionalities make it an ideal candidate for the synthesis of complex organic molecules, including natural products, pharmaceuticals, and other bioactive compounds.
Used in Advanced Chemical Synthesis:
Due to its unique chemical structure and reactivity, 4-(1,3-Dioxolan-2-yl)-2,6-dimethoxyphenylboronic Acid is used in advanced chemical synthesis for the preparation of complex organic compounds. Its protective functionalities and specific reactivity allow for the development of innovative synthetic routes, leading to the production of novel compounds with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 232275-38-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,3,2,2,7 and 5 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 232275-38:
(8*2)+(7*3)+(6*2)+(5*2)+(4*7)+(3*5)+(2*3)+(1*8)=116
116 % 10 = 6
So 232275-38-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H15BO6/c1-15-8-5-7(11-17-3-4-18-11)6-9(16-2)10(8)12(13)14/h5-6,11,13-14H,3-4H2,1-2H3
