23244-87-3 Usage
Uses
Used in Pharmaceutical Industry:
2,4,5-Triamino-pyridine is used as a key intermediate in the synthesis of pharmaceuticals for its ability to form complex molecular structures that can target specific biological pathways. Its versatility in chemical reactions allows for the development of new drugs with improved efficacy and reduced side effects.
Used in Agrochemical Industry:
In the agrochemical sector, 2,4,5-Triamino-pyridine serves as a crucial component in the creation of novel agrochemicals, such as herbicides, pesticides, and plant growth regulators. Its incorporation into these products enhances their effectiveness in protecting crops and improving agricultural yields.
Used in Organic Compounds Synthesis:
2,4,5-Triamino-pyridine is utilized as a building block in the synthesis of various organic compounds, including dyes, polymers, and other specialty chemicals. Its unique reactivity and structural features contribute to the development of innovative materials with diverse applications in industries such as textiles, plastics, and coatings.
Used in Research and Development:
As a valuable tool in the field of chemistry, 2,4,5-Triamino-pyridine is employed in research and development for exploring new chemical reactions, understanding molecular interactions, and designing advanced materials. Its unique properties make it an essential component in the advancement of scientific knowledge and the creation of new technologies.
Check Digit Verification of cas no
The CAS Registry Mumber 23244-87-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,2,4 and 4 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 23244-87:
(7*2)+(6*3)+(5*2)+(4*4)+(3*4)+(2*8)+(1*7)=93
93 % 10 = 3
So 23244-87-3 is a valid CAS Registry Number.
InChI:InChI=1/C5H8N4/c6-3-1-5(8)9-2-4(3)7/h1-2H,7H2,(H4,6,8,9)
23244-87-3Relevant academic research and scientific papers
Phenyl-aza-benzimidazole compounds for modulating IgE and inhibiting cellular proliferation
-
, (2008/06/13)
The present invention is directed to small molecule inhibitors of the IgE response to allergens, which are useful in the treatment of allergy and/or asthma or any diseases where IgE is pathogenic. This invention also relates to phenyl-aza-benzimidazole molecules that are cellular proliferation inhibitors and thus are useful as anticancer agents. This invention further relates to small molecules which suppress cytokines and leukocytes.
