23249-95-8 Usage
Uses
Used in Pharmaceutical Synthesis:
4-(5-Mercapto-1H-tetrazol-1-yl)benzoic acid is utilized as a key intermediate in the synthesis of pharmaceuticals due to its versatile chemical properties. The presence of both the tetrazole and thiol moieties, which are commonly found in active pharmaceutical ingredients, makes it a valuable building block for the development of new drugs.
Used in Agrochemical Synthesis:
In the agrochemical industry, 4-(5-Mercapto-1H-tetrazol-1-yl)benzoic acid serves as a crucial component in the synthesis of various agrochemicals. Its unique chemical structure allows for the creation of compounds with specific pesticidal or herbicidal properties, contributing to the development of more effective and targeted agricultural products.
Used in Organic Compounds Synthesis:
4-(5-Mercapto-1H-tetrazol-1-yl)benzoic acid is employed as a versatile building block in the synthesis of other organic compounds. Its ability to participate in various chemical reactions, such as nucleophilic substitution, addition, and condensation, makes it a valuable precursor for the creation of a wide range of organic molecules with diverse applications.
Used in Biological and Medicinal Applications:
Due to the presence of both the tetrazole and thiol moieties, 4-(5-Mercapto-1H-tetrazol-1-yl)benzoic acid may have potential biological and medicinal applications. These functional groups are often found in pharmaceuticals, suggesting that the compound could be used in the development of new therapeutic agents or as a component in drug delivery systems to improve the efficacy and bioavailability of existing medications.
Check Digit Verification of cas no
The CAS Registry Mumber 23249-95-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,2,4 and 9 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 23249-95:
(7*2)+(6*3)+(5*2)+(4*4)+(3*9)+(2*9)+(1*5)=108
108 % 10 = 8
So 23249-95-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H6N4O2S/c13-7(14)5-1-3-6(4-2-5)12-8(15)9-10-11-12/h1-4H,(H,13,14)(H,9,11,15)
23249-95-8Relevant academic research and scientific papers
COMPOUNDS THAT SELECTIVELY AND EFFECTIVELY INHIBIT HAKAI-MEDIATED UBIQUITINATION, AS ANTI-CANCER DRUGS
-
Paragraph 0122, (2020/06/04)
The present invention provides a class of compounds, which includes enantiomers and pharmaceutically acceptable salts thereof, that selectively and effectively inhibit Hakai-mediated ubiquitination, preferably without affecting Hakai protein levels, there
