23464-96-2 Usage
Description
3-[5-(4-BROMOPHENYL)-1,3-OXAZOL-2-YL]PROPANOIC ACID is a chemical compound that belongs to the group of oxazoles, which are heterocyclic aromatic compounds. It is a propanoic acid derivative with a 1,3-oxazole ring substituted by a 4-bromophenyl group. 3-[5-(4-BROMOPHENYL)-1,3-OXAZOL-2-YL]PROPANOIC ACID has potential biological activities and is often used in medicinal chemistry and drug discovery.
Used in Pharmaceutical Industry:
3-[5-(4-BROMOPHENYL)-1,3-OXAZOL-2-YL]PROPANOIC ACID is used as a potential therapeutic agent for various conditions due to its structural similarity to other nonsteroidal anti-inflammatory drugs. It may act as an anti-inflammatory, analgesic, or antipyretic agent, making it a valuable molecule for further research and development.
Used in Medicinal Chemistry Research:
3-[5-(4-BROMOPHENYL)-1,3-OXAZOL-2-YL]PROPANOIC ACID is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure and potential biological activities make it an important molecule for drug discovery and development.
Used in Drug Discovery:
3-[5-(4-BROMOPHENYL)-1,3-OXAZOL-2-YL]PROPANOIC ACID is used as a lead compound in the identification and development of new drugs. Its potential pharmacological properties, such as anti-inflammatory, analgesic, or antipyretic effects, make it a promising candidate for further research and development in the field of drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 23464-96-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,4,6 and 4 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 23464-96:
(7*2)+(6*3)+(5*4)+(4*6)+(3*4)+(2*9)+(1*6)=112
112 % 10 = 2
So 23464-96-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H10BrNO3/c13-9-3-1-8(2-4-9)10-7-14-11(17-10)5-6-12(15)16/h1-4,7H,5-6H2,(H,15,16)