235-21-2 Usage
Uses
Used in Pharmaceutical Industry:
[1,2,3]Triazolo[1,5-a]quinoline is used as a potential pharmacological agent for its antimicrobial, antiviral, anticancer, and anticonvulsant properties. Its diverse biological activities make it a promising candidate for the development of new drugs in the pharmaceutical industry.
Used in Enzyme Inhibition:
[1,2,3]Triazolo[1,5-a]quinoline derivatives are used as enzyme inhibitors, targeting specific enzymes to modulate biological processes and treat various diseases.
Used in Drug Discovery:
[1,2,3]Triazolo[1,5-a]quinoline is used as a ligand for various biological targets, aiding in the identification and development of new therapeutic agents.
The research and development of [1,2,3]Triazolo[1,5-a]quinoline derivatives continue to be of interest in the fields of medicinal chemistry and drug discovery due to their diverse biological activities and potential therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 235-21-2 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 2,3 and 5 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 235-21:
(5*2)+(4*3)+(3*5)+(2*2)+(1*1)=42
42 % 10 = 2
So 235-21-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H7N3/c1-2-4-10-8(3-1)5-6-9-7-11-12-13(9)10/h1-7H