2351-00-0 Usage
Uses
Used in Pharmaceutical Research:
2-(2,4-DIFLUOROANILINO)ACETOHYDRAZIDE is used as a research compound for its potential pharmaceutical applications, particularly in the development of antitubercular drugs. Its unique structure and properties make it a promising candidate for the treatment of tuberculosis.
Used in Organic Synthesis:
In the field of organic synthesis, 2-(2,4-DIFLUOROANILINO)ACETOHYDRAZIDE is utilized as a chemical intermediate. Its presence in the synthesis process allows for the creation of various other compounds, expanding the scope of chemical research and development.
Used in Chemical Production:
2-(2,4-DIFLUOROANILINO)ACETOHYDRAZIDE may also have applications in the production of other compounds, where its specific chemical properties can be leveraged to achieve desired outcomes in chemical reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 2351-00-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,3,5 and 1 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 2351-00:
(6*2)+(5*3)+(4*5)+(3*1)+(2*0)+(1*0)=50
50 % 10 = 0
So 2351-00-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H9F2N3O/c9-5-1-2-7(6(10)3-5)12-4-8(14)13-11/h1-3,12H,4,11H2,(H,13,14)
