2352-88-7 Usage
General Description
2-[[bis[2-[(1-oxooctadecyl)amino]ethyl]amino]carbonyl]benzoic acid is a long, complex chemical compound with a molecular structure consisting of two benzene rings connected by a carbon chain. The compound contains multiple amine and carbonyl functional groups, suggesting potential reactivity and interactions with biological systems. The presence of long-chain alkyl groups indicates that this compound may have surfactant properties or be involved in lipid interactions. The chemical name indicates that it is a carboxylic acid derivative, with the potential for acidity and the ability to form salts with other compounds. Overall, this compound contains a range of chemical features that make it potentially versatile and impactful in various fields such as pharmaceuticals, materials, and biological research.
Check Digit Verification of cas no
The CAS Registry Mumber 2352-88-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,3,5 and 2 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 2352-88:
(6*2)+(5*3)+(4*5)+(3*2)+(2*8)+(1*8)=77
77 % 10 = 7
So 2352-88-7 is a valid CAS Registry Number.
InChI:InChI=1/C48H85N3O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-37-45(52)49-39-41-51(47(54)43-35-33-34-36-44(43)48(55)56)42-40-50-46(53)38-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h33-36H,3-32,37-42H2,1-2H3,(H,49,52)(H,50,53)(H,55,56)