23576-89-8 Usage
Description
6-Chloro-5-nitroimidazo[2,1-b][1,3]thiazole is a chemical compound with the molecular formula C5H3ClN4O2S. It is a nitroimidazole derivative featuring a thiazole ring, with a chlorine atom and a nitro group attached to the imidazole ring. 6-Chloro-5-nitroimidazo[2,1-b][1,3]thiazole has been studied for its potential use as a pharmaceutical drug, particularly as an antibacterial and antiprotozoal agent. It is known for its ability to inhibit the growth of certain microorganisms, making it a promising candidate for the development of new antibiotics. Additionally, it has been investigated for its potential use in cancer treatment and as a radiosensitizer in cancer therapy. Further research is ongoing to explore the full range of its pharmacological properties and potential applications.
Uses
Used in Pharmaceutical Industry:
6-Chloro-5-nitroimidazo[2,1-b][1,3]thiazole is used as an antibacterial agent for its ability to inhibit the growth of certain microorganisms, making it a promising candidate for the development of new antibiotics.
Used in Antiprotozoal Applications:
In the field of antiprotozoal treatment, 6-Chloro-5-nitroimidazo[2,1-b][1,3]thiazole is used to target and inhibit the growth of protozoan parasites, offering a potential therapeutic solution for related infections.
Used in Cancer Treatment:
6-Chloro-5-nitroimidazo[2,1-b][1,3]thiazole is being investigated for its potential use in cancer treatment, suggesting that it may have properties that can be leveraged to combat cancer cells.
Used as a Radiosensitizer in Cancer Therapy:
In cancer therapy, 6-Chloro-5-nitroimidazo[2,1-b][1,3]thiazole is being studied for its potential as a radiosensitizer, which could enhance the effectiveness of radiation treatments by making cancer cells more susceptible to the damaging effects of radiation.
Check Digit Verification of cas no
The CAS Registry Mumber 23576-89-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,5,7 and 6 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 23576-89:
(7*2)+(6*3)+(5*5)+(4*7)+(3*6)+(2*8)+(1*9)=128
128 % 10 = 8
So 23576-89-8 is a valid CAS Registry Number.
InChI:InChI=1/C5H2ClN3O2S/c6-3-4(9(10)11)8-1-2-12-5(8)7-3/h1-2H
