235782-02-2 Usage
Molecular structure
2-([7-(DIMETHYLAMINO)-4,4A,5,6-TETRAHYDRO-2(3H)-NAPHTHALENYLIDENE]METHYL)-3-ETHYL-1,3-BENZOTHIAZOL-3-IUM PERCHLORATE is a complex organic compound with a benzothiazolium moiety, a dimethylamino group, an ethyl group, a naphthalenylidene group, and a perchlorate counterion.
Potential applications
This compound may have potential applications in the fields of organic synthesis, medicinal chemistry, or biological research due to its unique structure and properties.
Need for further studies
To fully understand the potential uses and effects of this compound, additional research and studies are likely needed.
Ionic nature
The presence of the perchlorate counterion indicates that the compound is ionic, which may affect its solubility, reactivity, and other properties.
Functional groups
The compound contains several functional groups, including the benzothiazolium moiety, dimethylamino group, ethyl group, and naphthalenylidene group, which contribute to its chemical reactivity and properties.
Physical properties
The physical properties of the compound, such as melting point, boiling point, and solubility, may be affected by its complex structure and the presence of various functional groups and the perchlorate counterion.
Chemical properties
The compound's chemical properties, such as reactivity, polarity, and acidity, may be influenced by its molecular structure and the presence of various functional groups and the perchlorate counterion.
Check Digit Verification of cas no
The CAS Registry Mumber 235782-02-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,3,5,7,8 and 2 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 235782-02:
(8*2)+(7*3)+(6*5)+(5*7)+(4*8)+(3*2)+(2*0)+(1*2)=142
142 % 10 = 2
So 235782-02-2 is a valid CAS Registry Number.
InChI:InChI=1/C22H27N2S.ClHO4/c1-4-24-20-7-5-6-8-21(20)25-22(24)14-16-9-10-17-11-12-19(23(2)3)15-18(17)13-16;2-1(3,4)5/h5-8,13-15,17H,4,9-12H2,1-3H3;(H,2,3,4,5)/q+1;/p-1