23589-03-9 Usage
Uses
Used in Pharmaceutical Industry:
3-[5-(4-FLUORO-PHENYL)-FURAN-2-YL]-PROPIONIC ACID is used as a pharmaceutical ingredient or intermediate for the synthesis of biologically active compounds due to its structural resemblance to NSAIDs, which may confer anti-inflammatory or analgesic properties.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 3-[5-(4-FLUORO-PHENYL)-FURAN-2-YL]-PROPIONIC ACID serves as a valuable compound for further exploration and development, potentially leading to the discovery of novel therapeutic agents with improved efficacy and reduced side effects compared to existing treatments.
Used in Drug Development:
3-[5-(4-FLUORO-PHENYL)-FURAN-2-YL]-PROPIONIC ACID is utilized in drug development as a starting material or scaffold for the creation of new pharmaceuticals, particularly those targeting inflammation and pain management, given its potential anti-inflammatory and analgesic properties.
Check Digit Verification of cas no
The CAS Registry Mumber 23589-03-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,5,8 and 9 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 23589-03:
(7*2)+(6*3)+(5*5)+(4*8)+(3*9)+(2*0)+(1*3)=119
119 % 10 = 9
So 23589-03-9 is a valid CAS Registry Number.
InChI:InChI=1/C13H11FO3/c14-10-3-1-9(2-4-10)12-7-5-11(17-12)6-8-13(15)16/h1-5,7H,6,8H2,(H,15,16)
