23612-35-3 Usage
Uses
Used in Pharmaceutical Research:
3-Nitro-5-azaindole is used as a building block in the synthesis of various biologically active compounds. Its unique chemical structure allows it to be a key component in the development of new pharmaceutical drugs.
Used in Antifungal and Antibacterial Applications:
3-Nitro-5-azaindole exhibits antifungal and antibacterial activity, making it a potential candidate for the development of new pharmaceutical drugs to combat infections caused by fungi and bacteria.
Used in Materials Science:
3-Nitro-5-azaindole has been studied for its potential applications in materials science, where its unique chemical properties can be utilized to develop new materials with specific characteristics.
Used in Organic Electronics:
3-Nitro-5-azaindole is also used in the field of organic electronics, where its properties can contribute to the development of new electronic devices and components.
3-Nitro-5-azaindole is a valuable compound for researchers and chemists in various fields, and its commercial availability makes it accessible for further exploration and application in different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 23612-35-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,6,1 and 2 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 23612-35:
(7*2)+(6*3)+(5*6)+(4*1)+(3*2)+(2*3)+(1*5)=83
83 % 10 = 3
So 23612-35-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H5N3O2/c11-10(12)7-4-9-6-3-8-2-1-5(6)7/h1-4,9H
23612-35-3Relevant academic research and scientific papers
OXALAMIDE COMPOUNDS AND COMPOSITIONS FOR TREATING CONDITIONS ASSOCIATED WITH STING ACTIVITY
-
Page/Page column 121, (2021/04/10)
This disclosure features chemical entities (e.g., a compound or a pharmaceutically acceptable salt, and/or hydrate, and/or cocrystal, and/or drug combination of the compound) that inhibit (e.g., antagonize) Stimulator of Interferon Genes (STING). Said che
