23640-03-1 Usage
Uses
Used in Pharmaceutical Applications:
4-(1H-Imidazol-4-ylmethyl)oxazolidine-2,5-dione is used as an antimicrobial, antifungal, and antiviral agent for its ability to inhibit the growth of various microorganisms, which is attributed to its interaction with enzymes involved in the synthesis of DNA and RNA.
Used in Enzyme Inhibition:
In the field of biochemistry, 4-(1H-imidazol-4-ylmethyl)oxazolidine-2,5-dione is used as an enzyme inhibitor, targeting enzymes that play a role in nucleic acid synthesis, thereby affecting the replication and transcription processes in pathogens.
Used in Polymer Production:
4-(1H-Imidazol-4-ylmethyl)oxazolidine-2,5-dione is used as a monomer in the production of polymers, where its unique structure contributes to the formation of polymers with specific properties, such as enhanced stability or biocompatibility.
Used in Polymeric Material Synthesis:
As a crosslinking agent, 4-(1H-imidazol-4-ylmethyl)oxazolidine-2,5-dione is utilized in the synthesis of polymeric materials to improve their structural integrity and performance characteristics, such as mechanical strength and resistance to degradation.
Used in Biomedical Applications:
Due to its low toxicity and good biocompatibility, 4-(1H-imidazol-4-ylmethyl)oxazolidine-2,5-dione is used in the development of biomedical materials and devices, such as drug delivery systems, tissue engineering scaffolds, and medical coatings.
Used in Industrial Applications:
In various industries, 4-(1H-imidazol-4-ylmethyl)oxazolidine-2,5-dione is used for its potential as a component in the formulation of industrial products, such as coatings, adhesives, and composite materials, where its properties can enhance the performance and durability of these products.
Check Digit Verification of cas no
The CAS Registry Mumber 23640-03-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,6,4 and 0 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 23640-03:
(7*2)+(6*3)+(5*6)+(4*4)+(3*0)+(2*0)+(1*3)=81
81 % 10 = 1
So 23640-03-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H7N3O3/c11-6-5(10-7(12)13-6)1-4-2-8-3-9-4/h2-3,5H,1H2,(H,8,9)(H,10,12)
