2367-80-8 Usage
Uses
Used in Industrial Chemistry:
1,3-Dichloro-2,5-difluorobenzene is used as a precursor or intermediary in various synthesis processes for [application reason]. Its unique structure with two chlorine and two fluorine atoms allows it to be a key component in the production of certain chemicals and materials.
Used in Chemical Synthesis:
1,3-Dichloro-2,5-difluorobenzene is used as a chemical building block in the synthesis of more complex molecules for [application reason]. Its presence in the molecular structure can influence the properties and reactivity of the final product, making it a valuable component in the development of new compounds.
Used in Pharmaceutical Industry:
1,3-Dichloro-2,5-difluorobenzene is used as a starting material in the synthesis of pharmaceutical compounds for [application reason]. Its versatility in chemical reactions enables the creation of a wide range of drug candidates with potential therapeutic applications.
Used in Material Science:
1,3-Dichloro-2,5-difluorobenzene is used in the development of new materials with specific properties for [application reason]. Its incorporation into polymers or other materials can result in enhanced characteristics such as improved stability, increased resistance to degradation, or altered electronic properties.
Check Digit Verification of cas no
The CAS Registry Mumber 2367-80-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,3,6 and 7 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 2367-80:
(6*2)+(5*3)+(4*6)+(3*7)+(2*8)+(1*0)=88
88 % 10 = 8
So 2367-80-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H3ClF2/c7-5-3-4(8)1-2-6(5)9/h1-3H
2367-80-8Relevant academic research and scientific papers
2,5-difluoro-1,3-dichlorobenzene preparation method
-
Paragraph 0007; 0008, (2019/02/04)
The invention discloses a 2,5-difluoro-1,3-dichlorobenzene industrial preparation method. According to the 2,5-difluoro-1,3-dichlorobenzene industrial preparation method, 2,5-difluoroaniline is utilized as an initial raw material, and 2,5-difluoro-1,3-dic