23694-46-4 Usage
Uses
Used in Organic Synthesis:
1-(o-chlorobenzyl)-1H-pyrrole is utilized as a building block in the synthesis of various organic compounds. Its unique structure and functional groups make it a valuable component in creating complex molecules for a range of applications.
Used in Pharmaceutical Industry:
1-(o-chlorobenzyl)-1H-pyrrole is used as a key intermediate in the development of new pharmaceuticals. Its potential anti-inflammatory and analgesic properties are being studied for the treatment of various conditions, including pain and inflammation-related disorders.
Used in Agrochemical Industry:
In the agrochemical sector, 1-(o-chlorobenzyl)-1H-pyrrole is employed as a starting material for the synthesis of various agrochemicals, such as pesticides and herbicides. Its unique chemical structure allows for the development of novel compounds with improved efficacy and selectivity in controlling pests and weeds.
Overall, 1-(o-chlorobenzyl)-1H-pyrrole is a versatile and valuable chemical compound with potential applications in various industries, including organic synthesis, pharmaceuticals, and agrochemicals. Its unique structure and properties make it a promising candidate for further research and development in these fields.
Check Digit Verification of cas no
The CAS Registry Mumber 23694-46-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,6,9 and 4 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 23694-46:
(7*2)+(6*3)+(5*6)+(4*9)+(3*4)+(2*4)+(1*6)=124
124 % 10 = 4
So 23694-46-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H10ClN/c12-11-6-2-1-5-10(11)9-13-7-3-4-8-13/h1-8H,9H2
23694-46-4Relevant academic research and scientific papers
Decarboxylative formation of N-alkyl pyrroles from 4-hydroxyproline
Deb, Indubhusan,Coiro, Daniel J.,Seidel, Daniel
scheme or table, p. 6473 - 6475 (2011/06/28)
N-Alkyl pyrroles are obtained in a single step from 4-hydroxyproline and aldehydes in just 15 min under microwave irradiation.
