2370-49-2 Usage
Uses
Used in Pharmaceutical Synthesis:
2-[(3,4-dimethylphenyl)amino]acetohydrazide is used as a reagent in the synthesis of pharmaceuticals and organic compounds. Its unique chemical structure allows it to be a versatile building block for the development of new drugs.
Used in Organic Chemistry Research:
As a reagent, 2-[(3,4-dimethylphenyl)amino]acetohydrazide is used in various organic chemistry research applications. Its ability to form different types of chemical bonds makes it a valuable tool for studying and creating new organic compounds.
Used in Biological Activity Studies:
2-[(3,4-dimethylphenyl)amino]acetohydrazide has been studied for its potential biological activities, including anti-inflammatory and anticancer properties. Its use in these studies helps researchers explore its therapeutic potential and understand its mechanism of action.
Check Digit Verification of cas no
The CAS Registry Mumber 2370-49-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,3,7 and 0 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 2370-49:
(6*2)+(5*3)+(4*7)+(3*0)+(2*4)+(1*9)=72
72 % 10 = 2
So 2370-49-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H15N3O/c1-7-3-4-9(5-8(7)2)12-6-10(14)13-11/h3-5,12H,6,11H2,1-2H3,(H,13,14)
