2377-81-3 Usage
Description
2,4,5,6-Tetrafluoroisophthalonitrile is an organic compound characterized by the presence of fluorine atoms at the 2, 4, 5, and 6 positions of the isophthalonitrile molecule. It is a solid with potential applications in various industries due to its unique chemical properties.
Uses
Used in Antimicrobial Applications:
2,4,5,6-Tetrafluoroisophthalonitrile is used as an antimicrobial agent for its activity against a range of microorganisms, including both Gram-positive bacteria (Staphylococcus aureus, Bacillus cereus) and Gram-negative bacteria (Escherichia coli, Pseudomonas aeruginosa), as well as fungi (Candida albicans). Its effectiveness in inhibiting the growth of these microorganisms makes it a valuable compound for studying and potentially developing new antimicrobial treatments and products.
Used in Chemical Synthesis:
As a solid organic compound with unique structural features, 2,4,5,6-Tetrafluoroisophthalonitrile can be used as a building block or intermediate in the synthesis of various chemical products. Its fluorinated structure may offer specific reactivity or selectivity in chemical reactions, making it a useful component in the development of new materials and compounds for different applications across various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 2377-81-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,3,7 and 7 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 2377-81:
(6*2)+(5*3)+(4*7)+(3*7)+(2*8)+(1*1)=93
93 % 10 = 3
So 2377-81-3 is a valid CAS Registry Number.
InChI:InChI=1/C8F4N2/c9-5-3(1-13)6(10)8(12)7(11)4(5)2-14