23784-15-8 Usage
Uses
Used in Pharmaceutical Industry:
Histidinal is used as an intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows it to be a key component in the development of drugs targeting specific biological pathways.
Used in Cosmetic Industry:
In the cosmetic industry, histidinal is used as an active ingredient in skincare products due to its potential benefits for the skin. It may help improve skin texture, reduce the appearance of fine lines and wrinkles, and provide antioxidant protection.
Used in Food Industry:
Histidinal can be used in the food industry as a flavor enhancer or a component in the production of certain additives. Its ability to interact with other molecules makes it a valuable asset in creating unique flavors and improving the overall taste of various food products.
Used in Research and Development:
Histidinal is also utilized in research and development for its potential applications in biotechnology and biochemistry. Scientists and researchers use it to study various biological processes and develop new methods for synthesizing complex molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 23784-15-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,7,8 and 4 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 23784-15:
(7*2)+(6*3)+(5*7)+(4*8)+(3*4)+(2*1)+(1*5)=118
118 % 10 = 8
So 23784-15-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H9N3O/c7-5(3-10)1-6-2-8-4-9-6/h2-5H,1,7H2,(H,8,9)/t5-/m0/s1
