23794-16-3 Usage
Uses
Used in Pharmaceutical Industry:
2-Bromo-1-(2-chloropyridin-4-yl)ethanone is used as a reagent for the synthesis of various pharmaceutical products. Its unique chemical structure allows it to participate in multiple reactions, contributing to the development of new drugs and therapeutic agents.
Used in Agrochemical Industry:
In the agrochemical sector, 2-Bromo-1-(2-chloropyridin-4-yl)ethanone is employed as a key intermediate in the production of agrochemicals. Its involvement in the synthesis of various agrochemicals aids in the development of effective pesticides, herbicides, and other crop protection agents.
Used in Material Science:
2-Bromo-1-(2-chloropyridin-4-yl)ethanone is utilized in the development of new materials, where its chemical properties can be harnessed to create innovative substances with unique properties. This contributes to advancements in various fields, including electronics, plastics, and other industries.
Used in Fine Chemicals Production:
2-Bromo-1-(2-chloropyridin-4-yl)ethanone is also used in the production of fine chemicals, where its specific chemical characteristics are essential for creating high-quality specialty chemicals used in various applications, such as fragrances, dyes, and other specialty products.
Safety and Handling:
It is crucial to handle 2-Bromo-1-(2-chloropyridin-4-yl)ethanone with care and store it in a cool, dry place away from direct sunlight and heat sources to ensure its stability and safety. Proper safety measures, including the use of personal protective equipment and adherence to safety protocols, should be followed when working with 2-Bromo-1-(2-chloropyridin-4-yl)ethanone to minimize potential hazards.
Check Digit Verification of cas no
The CAS Registry Mumber 23794-16-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,7,9 and 4 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 23794-16:
(7*2)+(6*3)+(5*7)+(4*9)+(3*4)+(2*1)+(1*6)=123
123 % 10 = 3
So 23794-16-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H5BrClNO/c8-4-6(11)5-1-2-10-7(9)3-5/h1-3H,4H2
