23799-60-2 Usage
Uses
Used in Organic Synthesis:
5-Chlorothianaphthene-3-acetonitrile is used as a synthetic intermediate for the preparation of other organic compounds. Its nitrile group can be involved in various chemical reactions, such as hydrolysis, reduction, and coupling, to produce a range of products with different functional groups and applications.
Used in Pharmaceutical Industry:
5-Chlorothianaphthene-3-acetonitrile is used as a building block in the synthesis of pharmaceutical compounds. Its unique structure and reactivity can be exploited to create new drug candidates with potential therapeutic applications.
Used in Agrochemical Industry:
5-Chlorothianaphthene-3-acetonitrile is used as a precursor in the development of agrochemicals, such as pesticides and herbicides. Its chemical properties can be tailored to target specific pests or weeds, improving the effectiveness and selectivity of these products.
Used in Material Science:
5-Chlorothianaphthene-3-acetonitrile is used as a component in the synthesis of advanced materials, such as polymers and composites. Its incorporation into these materials can impart new properties, such as improved strength, flexibility, or thermal stability.
Used in Research and Development:
5-Chlorothianaphthene-3-acetonitrile is used as a research compound in academic and industrial laboratories. Its unique structure and reactivity can provide insights into new chemical reactions, mechanisms, and applications, contributing to the advancement of scientific knowledge.
Check Digit Verification of cas no
The CAS Registry Mumber 23799-60-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,7,9 and 9 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 23799-60:
(7*2)+(6*3)+(5*7)+(4*9)+(3*9)+(2*6)+(1*0)=142
142 % 10 = 2
So 23799-60-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H6ClNS/c11-8-1-2-10-9(5-8)7(3-4-12)6-13-10/h1-2,5-6H,3H2
Xn:Harmful;
