23819-31-0 Usage
Uses
Used in Organic Synthesis:
Methyl 3-(Acetylamino)-2,3-dideoxy-4,6-O-benzylidene-α-D-ribo-hexopyranoside is used as a key intermediate in organic synthesis for the development of novel chemical compounds. Its unique structure allows for a wide range of reactions, making it a versatile building block for creating new molecules with potential applications in various industries.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, Methyl 3-(Acetylamino)-2,3-dideoxy-4,6-O-benzylidene-α-D-ribo-hexopyranoside is used as a starting material for the synthesis of various drug candidates. Its unique structure can be modified to create new molecules with potential therapeutic properties, contributing to the development of innovative treatments for various diseases and conditions.
Used in Chemical Research:
Methyl 3-(Acetylamino)-2,3-dideoxy-4,6-O-benzylidene-α-D-ribo-hexopyranoside is also used in chemical research as a model compound for studying the properties and reactivity of complex organic molecules. This helps researchers gain a deeper understanding of the underlying chemical principles and develop new strategies for designing and synthesizing novel compounds with specific applications.
Check Digit Verification of cas no
The CAS Registry Mumber 23819-31-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,8,1 and 9 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 23819-31:
(7*2)+(6*3)+(5*8)+(4*1)+(3*9)+(2*3)+(1*1)=110
110 % 10 = 0
So 23819-31-0 is a valid CAS Registry Number.
InChI:InChI=1/C16H21NO5/c1-10(18)17-12-8-14(19-2)21-13-9-20-16(22-15(12)13)11-6-4-3-5-7-11/h3-7,12-16H,8-9H2,1-2H3,(H,17,18)
23819-31-0Relevant academic research and scientific papers
Use of sodium borohydride for assisted reduction of secondary mesilates of diallylaminoglycosides. A new pathway for synthesis of L-daunosamine
Picq,Carret,Anker,Abou-Assali
, p. 1863 - 1866 (2007/10/02)
Secondary mesylate in trans relationship with diallylamino group is reduced by means of a participation reaction affording deoxygenated aminoglycosides; for one of them this reaction is a new pathway leading to L-daunosamine.
