238401-54-2 Usage
General Description
(-)-4'-fluorotartranilic acid is a chemical compound that is a derivative of 4'-fluorotartrate, a natural product found in grapefruit. It is a chiral molecule with a specific spatial arrangement of atoms, resulting in two mirror-image forms. (-)-4'-FLUOROTARTRANILIC ACID has potential pharmaceutical applications, as it has been studied for its inhibitory effects on certain enzymes involved in the biosynthesis of peptidoglycans, which are essential components of bacterial cell walls. Additionally, (-)-4'-fluorotartranilic acid has also been investigated for its potential as a building block in the synthesis of other chemical compounds with biological activity. Further research is needed to fully elucidate the potential uses and applications of this compound in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 238401-54-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,3,8,4,0 and 1 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 238401-54:
(8*2)+(7*3)+(6*8)+(5*4)+(4*0)+(3*1)+(2*5)+(1*4)=122
122 % 10 = 2
So 238401-54-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H10FNO5/c11-5-1-3-6(4-2-5)12-9(15)7(13)8(14)10(16)17/h1-4,7-8,13-14H,(H,12,15)(H,16,17)
