23893-84-7 Usage
Uses
Used in Flame Retardant Industry:
4,5-dibromohexahydrophthalic anhydride is used as a flame retardant for enhancing the fire resistance of materials, particularly in the production of epoxy resins. Its chemical properties contribute to reducing the flammability of these resins, making them safer for use in various applications.
Used as a Crosslinking Agent in Polymer Manufacturing:
In the polymer industry, 4,5-dibromohexahydrophthalic anhydride serves as a crosslinking agent. It helps in forming a network of chemical bonds between polymer chains, improving the overall strength, stability, and durability of the resulting polymer material.
Used as a Curing Agent in Adhesives and Coatings:
4,5-dibromohexahydrophthalic anhydride is also utilized as a curing agent in the production of adhesives and coatings. It aids in the hardening and setting process of these materials, providing improved adhesion, durability, and resistance to environmental factors.
Check Digit Verification of cas no
The CAS Registry Mumber 23893-84-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,8,9 and 3 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 23893-84:
(7*2)+(6*3)+(5*8)+(4*9)+(3*3)+(2*8)+(1*4)=137
137 % 10 = 7
So 23893-84-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H8Br2O3/c9-5-1-3-4(2-6(5)10)8(12)13-7(3)11/h3-6H,1-2H2
