239085-97-3 Usage
Uses
Used in Pharmaceutical Industry:
N-(2,2-DIETHOXYETHYL)-4-FLUOROANILINE is used as a building block for the production of various pharmaceuticals. Its unique structure allows it to be incorporated into the synthesis of a wide range of drug molecules, potentially leading to the development of new and improved medications.
Used in Agrochemical Industry:
N-(2,2-DIETHOXYETHYL)-4-FLUOROANILINE is used as a building block for the production of various agrochemicals. Its incorporation into the synthesis of agrochemicals can contribute to the development of more effective and targeted pest control solutions.
Used in Specialty Chemicals Industry:
N-(2,2-DIETHOXYETHYL)-4-FLUOROANILINE is used as a building block for the production of specialty chemicals. Its unique properties make it a valuable component in the synthesis of various specialty chemicals, which can be used in a wide range of applications, including coatings, adhesives, and sealants.
Used in Dyes and Pigments Industry:
N-(2,2-DIETHOXYETHYL)-4-FLUOROANILINE is used as an intermediate in the manufacture of dyes and pigments. Its presence in the synthesis process can contribute to the development of new and improved colorants for various industries, such as textiles, plastics, and printing inks.
Used in Fine Chemicals Industry:
N-(2,2-DIETHOXYETHYL)-4-FLUOROANILINE is used as an intermediate in the manufacture of fine chemicals. Its unique structure and properties make it a valuable component in the synthesis of various fine chemicals, which can be used in a wide range of applications, including fragrances, flavors, and cosmetics.
Check Digit Verification of cas no
The CAS Registry Mumber 239085-97-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,3,9,0,8 and 5 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 239085-97:
(8*2)+(7*3)+(6*9)+(5*0)+(4*8)+(3*5)+(2*9)+(1*7)=163
163 % 10 = 3
So 239085-97-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H18FNO2/c1-3-15-12(16-4-2)9-14-11-7-5-10(13)6-8-11/h5-8,12,14H,3-4,9H2,1-2H3
