24002-80-0 Usage
Description
METHYL 4-(3,4-DIAMINOPHENOXY)BENZENECARBOXYLATE, a chemical compound with the molecular formula C15H16N2O4, is a derivative of 3,4-diaminophenol. It serves as a crucial building block in the synthesis of various pharmaceuticals and organic compounds, playing a significant role in medicinal chemistry and drug discovery, as well as in the production of dyes and pigments. Due to its potential applications, it is essential to handle and use this compound with caution, adhering to proper safety protocols and guidelines.
Uses
Used in Pharmaceutical Industry:
METHYL 4-(3,4-DIAMINOPHENOXY)BENZENECARBOXYLATE is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the development of new drugs and therapeutic agents. Its unique chemical structure allows for the creation of compounds with potential medicinal properties, making it a valuable asset in drug discovery and design.
Used in Organic Compounds Synthesis:
In the field of organic chemistry, METHYL 4-(3,4-DIAMINOPHENOXY)BENZENECARBOXYLATE is used as a building block for the synthesis of a wide range of organic compounds. Its versatile structure enables the formation of various derivatives, which can be further utilized in different chemical reactions and applications.
Used in Dyes and Pigments Production:
METHYL 4-(3,4-DIAMINOPHENOXY)BENZENECARBOXYLATE is used as a raw material in the production of dyes and pigments due to its ability to impart color to various substances. Its chemical properties make it suitable for use in the creation of colorants for different industries, including textiles, plastics, and paints.
Check Digit Verification of cas no
The CAS Registry Mumber 24002-80-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,4,0,0 and 2 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 24002-80:
(7*2)+(6*4)+(5*0)+(4*0)+(3*2)+(2*8)+(1*0)=60
60 % 10 = 0
So 24002-80-0 is a valid CAS Registry Number.
InChI:InChI=1/C14H14N2O3/c1-18-14(17)9-2-4-10(5-3-9)19-11-6-7-12(15)13(16)8-11/h2-8H,15-16H2,1H3