2407-98-9 Usage
Uses
Used in Pharmaceutical Industry:
HEXAHYDRO-INDOLIZIN-8-ONE is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the development of drugs with antitumor, anti-inflammatory, antiviral, and antibacterial properties. Its versatile reactivity and structural features facilitate the creation of complex organic molecules, enhancing the therapeutic potential of new medications.
Used in Agrochemical Industry:
In the agrochemical sector, HEXAHYDRO-INDOLIZIN-8-ONE serves as a crucial building block for the synthesis of agrochemicals, leveraging its biological activities to develop products that can protect crops from diseases and pests, thereby increasing agricultural productivity and crop quality.
Used in Medicinal Chemistry Research:
HEXAHYDRO-INDOLIZIN-8-ONE is utilized as a valuable target in medicinal chemistry research, where its unique molecular architecture and diverse functional groups are explored for potential applications in drug discovery. HEXAHYDRO-INDOLIZIN-8-ONE's multifaceted biological activities make it an attractive candidate for the development of innovative therapeutic agents.
Used in Synthetic Chemistry:
As a versatile tool in synthetic chemistry, HEXAHYDRO-INDOLIZIN-8-ONE is employed in the production of complex organic molecules. Its structural features and reactivity allow for the synthesis of a wide range of compounds, broadening the scope of chemical research and applications across various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 2407-98-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,4,0 and 7 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 2407-98:
(6*2)+(5*4)+(4*0)+(3*7)+(2*9)+(1*8)=79
79 % 10 = 9
So 2407-98-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H13NO/c10-8-4-2-6-9-5-1-3-7(8)9/h7H,1-6H2
