24115-19-3 Usage
Uses
Used in Pharmaceutical Industry:
2-(2-chloro-4-fluorophenoxy)acetonitrile is utilized as an intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of new drugs with specific therapeutic properties. Its unique chemical structure allows for the creation of molecules with targeted actions, enhancing the efficacy and selectivity of medications.
Used in Agrochemical Industry:
In the agrochemical sector, 2-(2-chloro-4-fluorophenoxy)acetonitrile is employed as an intermediate in the production of herbicides and pesticides. Its herbicidal and pesticidal properties make it a valuable component in the development of agricultural chemicals that protect crops from weeds and pests, thereby increasing crop yields and ensuring food security.
Used in Chemical Industry:
2-(2-chloro-4-fluorophenoxy)acetonitrile serves as a building block in the chemical industry for the production of a variety of chemical products. Its versatile chemical structure allows for its incorporation into different chemical formulations, contributing to the development of new materials and compounds with diverse applications in various industries.
Overall, the unique chemical properties and structure of 2-(2-chloro-4-fluorophenoxy)acetonitrile make it a valuable compound in multiple industries, particularly in the development and synthesis of pharmaceuticals, agrochemicals, and other organic compounds. Its applications are driven by its ability to enhance the properties of these products, making it an essential component in the advancement of these fields.
Check Digit Verification of cas no
The CAS Registry Mumber 24115-19-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,4,1,1 and 5 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 24115-19:
(7*2)+(6*4)+(5*1)+(4*1)+(3*5)+(2*1)+(1*9)=73
73 % 10 = 3
So 24115-19-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H5ClFNO/c9-7-5-6(10)1-2-8(7)12-4-3-11/h1-2,5H,4H2
