24151-54-0 Usage
General Description
4-[[2-(acetoxy)ethyl](phenylmethyl)amino]-2-chloro-5-(2-methoxyethoxy)benzenediazonium tetrafluoroborate is a complex chemical compound with multiple functional groups. It consists of a diazonium cation with a tetrafluoroborate anion, and includes a chloro and a methoxyethoxy group. The compound also contains an acetoxyethyl and a phenylmethylamino group, making it a versatile reagent for chemical reactions. Due to its complex structure, the compound likely has a wide range of potential applications in organic synthesis, pharmaceuticals, and materials science. Additionally, the presence of the diazonium group suggests that it may be used in the preparation of azo dyes or other aromatic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 24151-54-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,4,1,5 and 1 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 24151-54:
(7*2)+(6*4)+(5*1)+(4*5)+(3*1)+(2*5)+(1*4)=80
80 % 10 = 0
So 24151-54-0 is a valid CAS Registry Number.
InChI:InChI=1/C20H23ClN3O4.BF4/c1-15(25)27-9-8-24(14-16-6-4-3-5-7-16)19-12-17(21)18(23-22)13-20(19)28-11-10-26-2;2-1(3,4)5/h3-7,12-13H,8-11,14H2,1-2H3;/q+1;-1