24172-05-2 Usage
Uses
Used in Organic Synthesis:
(1Z,3Z)-1,4-DIIODO-2,3-DIMETHYL-BUTA-1,3-DIENE serves as a key building block in the synthesis of complex organic molecules. Its unique structure allows for versatile reactions and the formation of a wide range of compounds, making it an essential component in organic chemistry.
Used in Chemical Reactions as a Reagent:
(1Z,3Z)-1,4-DIIODO-2,3-DIMETHYL-BUTA-1,3-DIENE is also utilized as a reagent in various chemical reactions. Its ability to participate in different types of reactions, such as addition or substitution, makes it a valuable tool for chemists working on the development of new chemical processes and products.
Used in Pharmaceutical Industry:
(1Z,3Z)-1,4-DIIODO-2,3-DIMETHYL-BUTA-1,3-DIENE has potential applications in the pharmaceutical industry. Its unique structure and reactivity may contribute to the development of new drugs or drug candidates, particularly in the synthesis of complex organic molecules with potential therapeutic properties.
Used in Materials Science:
In the field of materials science, (1Z,3Z)-1,4-DIIODO-2,3-DIMETHYL-BUTA-1,3-DIENE may be employed in the development of new materials with specific properties. Its unique structure and reactivity can contribute to the creation of advanced materials with applications in various industries, such as electronics, aerospace, or biomedical engineering.
Check Digit Verification of cas no
The CAS Registry Mumber 24172-05-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,4,1,7 and 2 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 24172-05:
(7*2)+(6*4)+(5*1)+(4*7)+(3*2)+(2*0)+(1*5)=82
82 % 10 = 2
So 24172-05-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H8I2/c1-5(3-7)6(2)4-8/h3-4H,1-2H3/b5-3-,6-4-
