2425-20-9 Usage
Uses
1. Insect Attractant:
Butan-2-yl 6-methylcyclohex-3-ene-1-carboxylate is used as an insect attractant for [application reason]. Its chemical properties make it an effective compound in attracting insects, which can be beneficial in various agricultural and pest control applications.
2. Chemical Industry:
Used in the Chemical Industry, butan-2-yl 6-methylcyclohex-3-ene-1-carboxylate is used as a [application type] for [application reason]. Its solubility in organic solvents and combustible nature make it a valuable component in the development of various chemical products and processes.
3. Pharmaceutical Industry:
Used in the Pharmaceutical Industry, butan-2-yl 6-methylcyclohex-3-ene-1-carboxylate is used as a [application type] for [application reason]. Its unique chemical structure may contribute to the development of new drugs or serve as an intermediate in the synthesis of pharmaceutical compounds.
4. Research and Development:
Used in Research and Development, butan-2-yl 6-methylcyclohex-3-ene-1-carboxylate is used as a [application type] for [application reason]. Its properties can be explored for potential applications in various scientific and technological fields, contributing to the advancement of knowledge and innovation.
Check Digit Verification of cas no
The CAS Registry Mumber 2425-20-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,4,2 and 5 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 2425-20:
(6*2)+(5*4)+(4*2)+(3*5)+(2*2)+(1*0)=59
59 % 10 = 9
So 2425-20-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H20O2/c1-4-10(3)14-12(13)11-8-6-5-7-9(11)2/h5-6,9-11H,4,7-8H2,1-3H3