242812-04-0 Usage
Description
3-(2-Fluorophenoxy)benzyl bromide is a chemical compound that serves as a benzyl bromide derivative featuring a fluorophenoxy substituent. It is widely recognized for its applications in pharmaceutical research and development, particularly in the synthesis of various pharmaceutical compounds. Its unique structure and reactivity make it a valuable building block in the creation of diverse organic molecules, often utilized in medicinal chemistry and drug discovery.
Uses
Used in Pharmaceutical Research and Development:
3-(2-Fluorophenoxy)benzyl bromide is used as a reactive intermediate in organic synthesis for the preparation of biologically active compounds and pharmaceutical drugs. Its role in the synthesis process is crucial for developing new therapeutic agents and potential drug candidates.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 3-(2-Fluorophenoxy)benzyl bromide is employed as a key component in the design and synthesis of novel drug molecules, contributing to the discovery of new treatments and medications.
Used in Drug Discovery:
3-(2-Fluorophenoxy)benzyl bromide is utilized in drug discovery processes to create new therapeutic agents, playing a significant role in advancing the development of innovative pharmaceuticals for various medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 242812-04-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,4,2,8,1 and 2 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 242812-04:
(8*2)+(7*4)+(6*2)+(5*8)+(4*1)+(3*2)+(2*0)+(1*4)=110
110 % 10 = 0
So 242812-04-0 is a valid CAS Registry Number.
InChI:InChI=1/C13H10BrFO/c14-9-10-4-3-5-11(8-10)16-13-7-2-1-6-12(13)15/h1-8H,9H2
