24294-01-7 Usage
Uses
Used in Organic Synthesis:
3-(N,N-Dimethoxyethyl)amino acetanilide is utilized as a key intermediate in organic synthesis for the creation of a variety of chemical compounds. Its unique structure allows for versatile reactions and modifications, making it a valuable component in the synthesis of complex organic molecules.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 3-(N,N-Dimethoxyethyl)amino acetanilide is employed as a precursor in the development of new drugs. Its structural features, including the dimethoxyethylamino group and the amino group, provide opportunities for the design of novel bioactive molecules with potential therapeutic applications.
Used in Drug Development:
3-(N,N-Dimethoxyethyl)amino acetanilide is used as a starting material for the synthesis of potential pharmaceuticals. Its reactivity and functional groups make it suitable for the creation of compounds that can target specific biological pathways or receptors, contributing to the advancement of new treatment options for various diseases.
Used in Bioactive Compound Development:
3-(N,N-Dimethoxyethyl)amino acetanilide is leveraged in the research and development of bioactive compounds. Its presence in molecular structures can influence the compound's interaction with biological systems, potentially leading to the discovery of new agents with significant biological activity.
Check Digit Verification of cas no
The CAS Registry Mumber 24294-01-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,4,2,9 and 4 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 24294-01:
(7*2)+(6*4)+(5*2)+(4*9)+(3*4)+(2*0)+(1*1)=97
97 % 10 = 7
So 24294-01-7 is a valid CAS Registry Number.
InChI:InChI=1/C14H22N2O3/c1-12(17)15-13-5-4-6-14(11-13)16(7-9-18-2)8-10-19-3/h4-6,11H,7-10H2,1-3H3,(H,15,17)
