24359-22-6 Usage
Uses
Used in Pharmaceutical Industry:
4-(9,10-dihydro-4H-benzo[4,5]cyclohepta[1,2-b]thien-4-ylidene)-1-methylpiperidinium hydrogen maleate is used as an active pharmaceutical ingredient for the development of new drugs targeting specific medical conditions. Its unique chemical structure allows for potential interactions with biological targets, making it a promising candidate for drug discovery and development.
Used in Chemical Research:
In the field of chemical research, 4-(9,10-dihydro-4H-benzo[4,5]cyclohepta[1,2-b]thien-4-ylidene)-1-methylpiperidinium hydrogen maleate can be used as a starting material or intermediate in the synthesis of other complex organic compounds. Its unique properties may enable the development of novel chemical reactions and the creation of new molecules with specific applications.
Used in Material Science:
The compound may also find applications in material science, where its unique chemical structure could be utilized to develop new materials with specific properties. These materials could have potential uses in various industries, such as electronics, aerospace, or automotive, depending on the desired characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 24359-22-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,4,3,5 and 9 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 24359-22:
(7*2)+(6*4)+(5*3)+(4*5)+(3*9)+(2*2)+(1*2)=106
106 % 10 = 6
So 24359-22-6 is a valid CAS Registry Number.
InChI:InChI=1/C19H21NS.C4H4O4/c1-20-11-8-15(9-12-20)19-16-5-3-2-4-14(16)6-7-18-17(19)10-13-21-18;5-3(6)1-2-4(7)8/h2-5,10,13H,6-9,11-12H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1-
