24370-73-8 Usage
Uses
Used in Organic Synthesis:
5-BENZYLOXY-1H-INDOLE-3-CARBOXYLIC ACID is used as a key intermediate in organic synthesis for the preparation of various complex organic molecules. Its unique structure allows for versatile chemical reactions, facilitating the creation of a wide range of compounds with potential applications in different fields.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 5-BENZYLOXY-1H-INDOLE-3-CARBOXYLIC ACID is utilized as a precursor for the development of new pharmaceuticals. Its biological activities, such as antibacterial, antifungal, and anticancer properties, make it a promising candidate for the treatment of various diseases and conditions.
Used in Pharmaceutical Industry:
5-BENZYLOXY-1H-INDOLE-3-CARBOXYLIC ACID is used as a building block in the pharmaceutical industry for the synthesis of drugs with potential therapeutic effects. The presence of the carboxylic acid group allows for easy derivatization and modification, enabling the design of novel drug molecules with improved pharmacological properties.
Used in Research and Development:
5-BENZYLOXY-1H-INDOLE-3-CARBOXYLIC ACID is employed as a subject of research and development in the field of organic chemistry. Its unique structure and potential reactivity offer opportunities for the exploration of new chemical reactions and the discovery of innovative synthetic pathways.
Used in Bioactive Compounds Synthesis:
In the synthesis of bioactive compounds, 5-BENZYLOXY-1H-INDOLE-3-CARBOXYLIC ACID is used as a valuable intermediate. Its incorporation into the molecular structures of these compounds can enhance their biological activities, leading to the development of new agents with potential applications in medicine and healthcare.
Check Digit Verification of cas no
The CAS Registry Mumber 24370-73-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,4,3,7 and 0 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 24370-73:
(7*2)+(6*4)+(5*3)+(4*7)+(3*0)+(2*7)+(1*3)=98
98 % 10 = 8
So 24370-73-8 is a valid CAS Registry Number.
InChI:InChI=1/C16H13NO3/c18-16(19)14-9-17-15-7-6-12(8-13(14)15)20-10-11-4-2-1-3-5-11/h1-9,17H,10H2,(H,18,19)
