24370-75-0 Usage
Uses
Used in Research and Development:
7-Benzyloxy-1H-Indole-3-Carboxylic Acid is used as a research compound for exploring its unique properties and potential applications in various scientific fields. Its presence of multiple functional groups allows for further chemical modifications and investigations into its interactions with other molecules.
Used in Biochemistry:
In the field of biochemistry, 7-Benzyloxy-1H-Indole-3-Carboxylic Acid is used as a starting material or intermediate in the synthesis of biologically active molecules. Its indole structure is common in many natural products and pharmaceuticals, making it a valuable component in the development of new drugs and therapeutic agents.
Used in Medicinal Chemistry:
7-Benzyloxy-1H-Indole-3-Carboxylic Acid is utilized as a building block in medicinal chemistry for the design and synthesis of novel drug candidates. Its unique structure and functional groups can be exploited to create molecules with specific biological activities, potentially leading to the discovery of new treatments for various diseases.
Used in Material Science:
In material science, 7-Benzyloxy-1H-Indole-3-Carboxylic Acid may be employed as a component in the development of new materials with specialized properties. Its aromatic and heterocyclic nature could contribute to the creation of materials with unique electronic, optical, or mechanical characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 24370-75-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,4,3,7 and 0 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 24370-75:
(7*2)+(6*4)+(5*3)+(4*7)+(3*0)+(2*7)+(1*5)=100
100 % 10 = 0
So 24370-75-0 is a valid CAS Registry Number.
InChI:InChI=1/C16H13NO3/c18-16(19)13-9-17-15-12(13)7-4-8-14(15)20-10-11-5-2-1-3-6-11/h1-9,17H,10H2,(H,18,19)
24370-75-0Relevant academic research and scientific papers
BENZOIMIDAZOLE DERIVATIVES AND GLYCOGEN SYNTHASE KINASE-3 BETA INHIBITORS CONTAINING THE SAME
-
Page/Page column 78, (2010/04/03)
Benzoimidazole Derivatives are provided. The compounds of the present invention are useful for Glycogen Synthase Kinase-3 Beta Inhibitors.
