24372-73-4 Usage
Chemical structure
The compound consists of a 1,3-dithiol-2-ylidene ring attached to a tetrahydro-2H-pyridine ring with a 4-methoxyphenyl group. Sulfuric acid is also present in 1-[4-(4-methoxyphenyl)-1,3-dithiol-2-ylidene]-3,4,5,6-tetrahydro-2H-py ridine, sulfuric acid.
Organic properties
Due to the presence of the dithiol and pyridine moieties, 1-[4-(4-methoxyphenyl)-1,3-dithiol-2-ylidene]-3,4,5,6-tetrahydro-2H-py ridine, sulfuric acid is likely to have organic properties.
Acidic properties
The presence of sulfuric acid in the compound suggests that it may exhibit acidic properties.
Aromatic characteristics
The 4-methoxyphenyl group in the compound indicates potential aromatic properties.
Electron-donating characteristics
The methoxy group in the 4-methoxyphenyl group suggests that the compound may have electron-donating properties.
Potential applications
Given its unique chemical structure and properties, 1-[4-(4-methoxyphenyl)-1,3-dithiol-2-ylidene]-3,4,5,6-tetrahydro-2H-py ridine, sulfuric acid may be relevant in the fields of organic chemistry, pharmaceuticals, or materials science.
Further research needed
To fully understand the chemical behavior and potential applications of 1-[4-(4-methoxyphenyl)-1,3-dithiol-2-ylidene]-3,4,5,6-tetrahydro-2H-py ridine, sulfuric acid, further research and analysis are necessary.
Check Digit Verification of cas no
The CAS Registry Mumber 24372-73-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,4,3,7 and 2 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 24372-73:
(7*2)+(6*4)+(5*3)+(4*7)+(3*2)+(2*7)+(1*3)=104
104 % 10 = 4
So 24372-73-4 is a valid CAS Registry Number.
InChI:InChI=1/C15H18NOS2.H2O4S/c1-17-13-7-5-12(6-8-13)14-11-18-15(19-14)16-9-3-2-4-10-16;1-5(2,3)4/h5-8,11H,2-4,9-10H2,1H3;(H2,1,2,3,4)/q+1;/p-1
