244022-69-3 Usage
General Description
1-(2-Chloro-6-fluorobenzyl)-1,4-diazepane is a chemical compound with the molecular formula C15H18ClFN3. It is a benzyl-diazepane derivative with a chlorine and fluorine atom attached to the benzyl group. 1-(2-CHLORO-6-FLUOROBENZYL)-1,4-DIAZEPANE has potential applications in medicinal chemistry, particularly in the development of new pharmaceuticals. Its structure and properties make it a potential candidate for drug discovery and development, as it has been found to exhibit certain pharmacological activities. Further research into the compound's potential therapeutic uses and mechanisms of action may lead to the development of new drugs for various medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 244022-69-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,4,4,0,2 and 2 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 244022-69:
(8*2)+(7*4)+(6*4)+(5*0)+(4*2)+(3*2)+(2*6)+(1*9)=103
103 % 10 = 3
So 244022-69-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H16ClFN2.2ClH/c13-11-3-1-4-12(14)10(11)9-16-7-2-5-15-6-8-16;;/h1,3-4,15H,2,5-9H2;2*1H
