245057-65-2 Usage
Uses
Used in Pharmaceutical Research and Development:
4-(2-CHLOROPHENOXY)PIPERIDINE is used as a chemical intermediate for the synthesis of new drugs and compounds. Its unique structure and potential biological activity make it a valuable candidate for the development of novel therapeutic agents.
Used in Chemical Research:
In the field of chemical research, 4-(2-CHLOROPHENOXY)PIPERIDINE is used as a building block for the creation of various organic compounds. Its versatile structure allows for the exploration of new chemical reactions and the synthesis of innovative molecules with potential applications in various industries.
Used in Drug Discovery:
4-(2-CHLOROPHENOXY)PIPERIDINE is used as a lead compound in drug discovery, where its potential therapeutic properties are investigated. Its unique structure and possible biological activity make it a promising candidate for the development of new pharmaceuticals.
Used in Medicinal Chemistry:
In medicinal chemistry, 4-(2-CHLOROPHENOXY)PIPERIDINE is used as a template for the design and optimization of new drug candidates. Its structural features can be modified to improve pharmacokinetic and pharmacodynamic properties, leading to the development of more effective and safer medications.
Check Digit Verification of cas no
The CAS Registry Mumber 245057-65-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,4,5,0,5 and 7 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 245057-65:
(8*2)+(7*4)+(6*5)+(5*0)+(4*5)+(3*7)+(2*6)+(1*5)=132
132 % 10 = 2
So 245057-65-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H14ClNO/c12-10-3-1-2-4-11(10)14-9-5-7-13-8-6-9/h1-4,9,13H,5-8H2
