2452-25-7 Usage
Uses
Used in Pharmaceutical Research:
2-(5-Methoxy-1H-indol-3-yl)-acetamide is used as a research compound for the development of new drugs targeting neurological and psychiatric disorders. Its unique structure and potential biological activities make it a valuable tool in the discovery and optimization of therapeutic agents.
Used in Neurological Applications:
In the field of neurology, 2-(5-Methoxy-1H-indol-3-yl)-acetamide is used as a potential therapeutic agent for the treatment of various neurological disorders. Its ability to modulate specific biological pathways and receptors involved in these conditions makes it a promising candidate for further research and development.
Used in Psychiatric Applications:
2-(5-Methoxy-1H-indol-3-yl)-acetamide is also used in psychiatric research as a potential treatment for mental health disorders. Its potential to influence neurotransmitter systems and other biological mechanisms associated with psychiatric conditions positions it as a candidate for the development of novel therapeutic interventions.
Used in Chemical Synthesis:
In the chemical industry, 2-(5-Methoxy-1H-indol-3-yl)-acetamide may be used as a starting material or intermediate in the synthesis of other related compounds with potential applications in various fields, including pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 2452-25-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,4,5 and 2 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 2452-25:
(6*2)+(5*4)+(4*5)+(3*2)+(2*2)+(1*5)=67
67 % 10 = 7
So 2452-25-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H12N2O2/c1-15-8-2-3-10-9(5-8)7(6-13-10)4-11(12)14/h2-3,5-6,13H,4H2,1H3,(H2,12,14)
