2454-96-8 Usage
Uses
Used in Pharmaceutical Industry:
2-Amino-5-methylpyridine is used as an intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of new drugs with specific therapeutic properties. Its unique structure allows for the creation of molecules with targeted actions, enhancing the effectiveness of medications.
Used in Agrochemical Industry:
In the agrochemical sector, 2-Amino-5-methylpyridine is utilized as a precursor in the production of agrochemicals, such as pesticides and herbicides. Its incorporation aids in the design of compounds that can effectively control, repel, or kill pests, thereby protecting crops and improving agricultural yields.
Used in Dye Industry:
2-Amino-5-methylpyridine is employed as a key component in the synthesis of dyes, where its chemical structure contributes to the color and stability of the resulting dyes. This makes it valuable for applications in textiles, printing inks, and other industries that rely on colorants for their products.
Used in Organic Compounds Production:
As a building block, 2-Amino-5-methylpyridine is instrumental in the production of a variety of organic compounds. Its presence in these compounds can influence their chemical and physical properties, making it a crucial component in the development of new materials and chemical entities.
Check Digit Verification of cas no
The CAS Registry Mumber 2454-96-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,4,5 and 4 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 2454-96:
(6*2)+(5*4)+(4*5)+(3*4)+(2*9)+(1*6)=88
88 % 10 = 8
So 2454-96-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H8N2/c1-5-2-3-6(7)8-4-5/h2-4H,1H3,(H2,7,8)/p+1
